C12H19N5O2S — CID 134416273
2-amino-N-(benzenesulfinyl)-5-(diaminomethylideneamino)pentanamide (PubChem CID 134416273) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-amino-N-(benzenesulfinyl)-5-(diaminomethylideneamino)pentanamide.
| Compound Name | 2-amino-N-(benzenesulfinyl)-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 134416273 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-amino-N-(benzenesulfinyl)-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(N)=NCCCC(N)C(=O)NS(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19N5O2S/c13-10(7-4-8-16-12(14)15)11(18)17-20(19)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,13H2,(H,17,18)(H4,14,15,16) |
| InChIKey | DNZABGXLBSLRIH-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|