C8H18ClN5O3 — CID 133113849
2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid;hydrochloride (PubChem CID 133113849) has the molecular formula C8H18ClN5O3 and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid;hydrochloride.
| Compound Name | 2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 133113849 |
| Molecular Formula | C8H18ClN5O3 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid;hydrochloride |
| SMILES | Cl.NC(N)=NCCC[C@@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C8H17N5O3.ClH/c9-5(2-1-3-12-8(10)11)7(16)13-4-6(14)15;/h5H,1-4,9H2,(H,13,16)(H,14,15)(H4,10,11,12);1H/t5-;/m1./s1 |
| InChIKey | LBJDXUKLQUTBSV-NUBCRITNSA-N |
| XLogP | -2.01 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|