C10H22N6O3 — CID 87289489
(2S)-2-amino-4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butanoic acid (PubChem CID 87289489) has the molecular formula C10H22N6O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2S)-2-amino-4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 87289489 |
| Molecular Formula | C10H22N6O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (2S)-2-amino-4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H22N6O3/c11-6(2-1-4-16-10(13)14)8(17)15-5-3-7(12)9(18)19/h6-7H,1-5,11-12H2,(H,15,17)(H,18,19)(H4,13,14,16)/t6?,7-/m0/s1 |
| InChIKey | WHYGZVAHHCWORJ-MLWJPKLSSA-N |
| XLogP | -2.71 |
| TPSA | 182.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|