C6H15ClN4O2 — CID 135705200
(2R)-2-amino-5-(diamino(113C)methylideneamino)(1,2,3,4,5-13C5)pentanoic acid;hydrochloride (PubChem CID 135705200) has the molecular formula C6H15ClN4O2 and a molecular weight of 216.62 g/mol. Its IUPAC name is (2R)-2-amino-5-(diamino(113C)methylideneamino)(1,2,3,4,5-13C5)pentanoic acid;hydrochloride.
| Compound Name | (2R)-2-amino-5-(diamino(113C)methylideneamino)(1,2,3,4,5-13C5)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 135705200 |
| Molecular Formula | C6H15ClN4O2 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (2R)-2-amino-5-(diamino(113C)methylideneamino)(1,2,3,4,5-13C5)pentanoic acid;hydrochloride |
| SMILES | Cl.N[13C](N)=N[13CH2][13CH2][13CH2][13C@@H](N)[13C](=O)O |
| InChI | InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m1./s1/i1+1,2+1,3+1,4+1,5+1,6+1; |
| InChIKey | KWTQSFXGGICVPE-ZLMAMRJUSA-N |
| XLogP | -1.13 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|