C8H19ClN4O4 — CID 175411630
acetic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride (PubChem CID 175411630) has the molecular formula C8H19ClN4O4 and a molecular weight of 270.72 g/mol. Its IUPAC name is acetic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride.
| Compound Name | acetic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 175411630 |
| Molecular Formula | C8H19ClN4O4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | acetic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| SMILES | CC(=O)O.Cl.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C2H4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;1-2(3)4;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H3,(H,3,4);1H/t4-;;/m0../s1 |
| InChIKey | GMEXKGBHZRGIAL-FHNDMYTFSA-N |
| XLogP | -1.04 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|