C8H17N4NaO4 — CID 87670814
sodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;acetate (PubChem CID 87670814) has the molecular formula C8H17N4NaO4 and a molecular weight of 256.24 g/mol. Its IUPAC name is sodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;acetate.
| Compound Name | sodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;acetate |
|---|---|
| PubChem CID | 87670814 |
| Molecular Formula | C8H17N4NaO4 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | sodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;acetate |
| SMILES | CC(=O)[O-].NC(N)=NCCCC(N)C(=O)O.[Na+] |
| InChI | InChI=1S/C6H14N4O2.C2H4O2.Na/c7-4(5(11)12)2-1-3-10-6(8)9;1-2(3)4;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | CXKVACLNGYVMTI-UHFFFAOYSA-M |
| XLogP | -5.79 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | -5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|