C11H21N5Na2O6 — CID 174872928
disodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminopentanedioate (PubChem CID 174872928) has the molecular formula C11H21N5Na2O6 and a molecular weight of 365.30 g/mol. Its IUPAC name is disodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminopentanedioate.
| Compound Name | disodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminopentanedioate |
|---|---|
| PubChem CID | 174872928 |
| Molecular Formula | C11H21N5Na2O6 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | disodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminopentanedioate |
| SMILES | NC(CCC(=O)[O-])C(=O)[O-].NC(N)=NCCCC(N)C(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C6H14N4O2.C5H9NO4.2Na/c7-4(5(11)12)2-1-3-10-6(8)9;6-3(5(9)10)1-2-4(7)8;;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2,6H2,(H,7,8)(H,9,10);;/q;;2*+1/p-2 |
| InChIKey | CMYOZUYPPBATLR-UHFFFAOYSA-L |
| XLogP | -10.95 |
| TPSA | 234.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -10.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|