C12H26CoN8O4 — CID 87871094
bis((2S)-2-amino-5-(diaminomethylideneamino)pentanoate);cobalt(2+) (PubChem CID 87871094) has the molecular formula C12H26CoN8O4 and a molecular weight of 405.33 g/mol. Its IUPAC name is bis((2S)-2-amino-5-(diaminomethylideneamino)pentanoate);cobalt(2+).
| Compound Name | bis((2S)-2-amino-5-(diaminomethylideneamino)pentanoate);cobalt(2+) |
|---|---|
| PubChem CID | 87871094 |
| Molecular Formula | C12H26CoN8O4 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | bis((2S)-2-amino-5-(diaminomethylideneamino)pentanoate);cobalt(2+) |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)[O-].NC(N)=NCCC[C@H](N)C(=O)[O-].[Co+2] |
| InChI | InChI=1S/2C6H14N4O2.Co/c2*7-4(5(11)12)2-1-3-10-6(8)9;/h2*4H,1-3,7H2,(H,11,12)(H4,8,9,10);/q;;+2/p-2/t2*4-;/m00./s1 |
| InChIKey | REFCNSKDIVCPFC-SCGRZTRASA-L |
| XLogP | -5.77 |
| TPSA | 261.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|