(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride

C6H13FN4O — CID 54568309

IUPAC(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride
SMILESNC(N)=NCCC[C@H](N)C(=O)F
InChIInChI=1S/C6H13FN4O/c7-5(12)4(8)2-1-3-11-6(9)10/h4H,1-3,8H2,(H4,9,10,11)/t4-/m0/s1
InChIKeyZVKQACSHNWKLPG-BYPYZUCNSA-N
MW176.20 g/mol
LogP-1.14
Rot. Bonds5

About (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride

(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride (PubChem CID 54568309) has the molecular formula C6H13FN4O and a molecular weight of 176.20 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride.

Molecular Properties

Compound Name(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride
PubChem CID54568309
Molecular FormulaC6H13FN4O
Molecular Weight176.20 g/mol
Exact Mass176.11
IUPAC Name(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride
SMILESNC(N)=NCCC[C@H](N)C(=O)F
InChIInChI=1S/C6H13FN4O/c7-5(12)4(8)2-1-3-11-6(9)10/h4H,1-3,8H2,(H4,9,10,11)/t4-/m0/s1
InChIKeyZVKQACSHNWKLPG-BYPYZUCNSA-N
XLogP-1.14
TPSA107.49 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.20
LogP ≤ 5-1.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride?
The IUPAC name of (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride (CID 54568309) is (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride.
What is the SMILES notation for (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride?
The canonical SMILES for (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride is NC(N)=NCCC[C@H](N)C(=O)F.
What is the InChIKey of (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride?
The InChIKey is ZVKQACSHNWKLPG-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H13FN4O/c7-5(12)4(8)2-1-3-11-6(9)10/h4H,1-3,8H2,(H4,9,10,11)/t4-/m0/s1.
What are the key properties of (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride?
(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride has a molecular weight of 176.20 g/mol, XLogP of -1.14, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl fluoride is sourced from PubChem (CID 54568309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).