C6H13N4NaO2 — CID 23693954
sodium (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 23693954) has the molecular formula C6H13N4NaO2 and a molecular weight of 196.19 g/mol. Its IUPAC name is sodium (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | sodium (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 23693954 |
| Molecular Formula | C6H13N4NaO2 |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | sodium (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H14N4O2.Na/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);/q;+1/p-1/t4-;/m0./s1 |
| InChIKey | YFGAFXCSLUUJRG-WCCKRBBISA-M |
| XLogP | -5.88 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | -5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|