C6H14N4O2Ru+2 — CID 23025269
2-amino-5-(diaminomethylideneamino)pentanoic acid;ruthenium(2+) (PubChem CID 23025269) has the molecular formula C6H14N4O2Ru+2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;ruthenium(2+).
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;ruthenium(2+) |
|---|---|
| PubChem CID | 23025269 |
| Molecular Formula | C6H14N4O2Ru+2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;ruthenium(2+) |
| SMILES | NC(N)=NCCCC(N)C(=O)O.[Ru+2] |
| InChI | InChI=1S/C6H14N4O2.Ru/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);/q;+2 |
| InChIKey | MBTALRWDPXYNGR-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|