C9H21N5O4 — CID 21226270
2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminopropanoic acid (PubChem CID 21226270) has the molecular formula C9H21N5O4 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminopropanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminopropanoic acid |
|---|---|
| PubChem CID | 21226270 |
| Molecular Formula | C9H21N5O4 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminopropanoic acid |
| SMILES | CC(N)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C3H7NO2/c7-4(5(11)12)2-1-3-10-6(8)9;1-2(4)3(5)6/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2H,4H2,1H3,(H,5,6) |
| InChIKey | QDOVMBSZOOJLGR-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 191.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|