C6H14ClN4NaO2 — CID 87252256
sodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;chloride (PubChem CID 87252256) has the molecular formula C6H14ClN4NaO2 and a molecular weight of 232.65 g/mol. Its IUPAC name is sodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;chloride.
| Compound Name | sodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;chloride |
|---|---|
| PubChem CID | 87252256 |
| Molecular Formula | C6H14ClN4NaO2 |
| Molecular Weight | 232.65 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | sodium;2-amino-5-(diaminomethylideneamino)pentanoic acid;chloride |
| SMILES | NC(N)=NCCCC(N)C(=O)O.[Cl-].[Na+] |
| InChI | InChI=1S/C6H14N4O2.ClH.Na/c7-4(5(11)12)2-1-3-10-6(8)9;;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H;/q;;+1/p-1 |
| InChIKey | NPJMDBHUQHLEPR-UHFFFAOYSA-M |
| XLogP | -7.54 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.65 |
| LogP ≤ 5 | -7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|