C6H20N5O2P — CID 175416337
2-amino-5-(diaminomethylideneamino)pentanoic acid;azane;phosphane (PubChem CID 175416337) has the molecular formula C6H20N5O2P and a molecular weight of 225.23 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;azane;phosphane.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;azane;phosphane |
|---|---|
| PubChem CID | 175416337 |
| Molecular Formula | C6H20N5O2P |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;azane;phosphane |
| SMILES | N.NC(N)=NCCCC(N)C(=O)O.P |
| InChI | InChI=1S/C6H14N4O2.H3N.H3P/c7-4(5(11)12)2-1-3-10-6(8)9;;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2*1H3 |
| InChIKey | KUVPGYPFNVHFSG-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 162.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|