C7H16N4O5 — CID 10198591
2-amino-5-(diaminomethylideneamino)pentanoic acid;carbonic acid (PubChem CID 10198591) has the molecular formula C7H16N4O5 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;carbonic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;carbonic acid |
|---|---|
| PubChem CID | 10198591 |
| Molecular Formula | C7H16N4O5 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;carbonic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=C(O)O |
| InChI | InChI=1S/C6H14N4O2.CH2O3/c7-4(5(11)12)2-1-3-10-6(8)9;2-1(3)4/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);(H2,2,3,4) |
| InChIKey | RYJDNPSQBGFFSF-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|