C8H20N4O4 — CID 155169115
2-amino-5-(diaminomethylideneamino)pentanoic acid;ethane-1,2-diol (PubChem CID 155169115) has the molecular formula C8H20N4O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;ethane-1,2-diol.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 155169115 |
| Molecular Formula | C8H20N4O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;ethane-1,2-diol |
| SMILES | NC(N)=NCCCC(N)C(=O)O.OCCO |
| InChI | InChI=1S/C6H14N4O2.C2H6O2/c7-4(5(11)12)2-1-3-10-6(8)9;3-1-2-4/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3-4H,1-2H2 |
| InChIKey | YAMUAAODLHRDRY-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|