C12H28N6O8 — CID 158065697
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;bis((2S)-2-amino-3-hydroxypropanoic acid) (PubChem CID 158065697) has the molecular formula C12H28N6O8 and a molecular weight of 384.39 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;bis((2S)-2-amino-3-hydroxypropanoic acid).
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;bis((2S)-2-amino-3-hydroxypropanoic acid) |
|---|---|
| PubChem CID | 158065697 |
| Molecular Formula | C12H28N6O8 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;bis((2S)-2-amino-3-hydroxypropanoic acid) |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.N[C@@H](CO)C(=O)O.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.2C3H7NO3/c7-4(5(11)12)2-1-3-10-6(8)9;2*4-2(1-5)3(6)7/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2*2,5H,1,4H2,(H,6,7)/t4-;2*2-/m000/s1 |
| InChIKey | FLERXBZNUGSRHK-NYWHIHTDSA-N |
| XLogP | -4.77 |
| TPSA | 294.82 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -4.77 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|