C12H30N8O3 — CID 154790102
2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(4-amino-5-hydroxypentyl)guanidine (PubChem CID 154790102) has the molecular formula C12H30N8O3 and a molecular weight of 334.43 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(4-amino-5-hydroxypentyl)guanidine.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(4-amino-5-hydroxypentyl)guanidine |
|---|---|
| PubChem CID | 154790102 |
| Molecular Formula | C12H30N8O3 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(4-amino-5-hydroxypentyl)guanidine |
| SMILES | NC(N)=NCCCC(N)C(=O)O.NC(N)=NCCCC(N)CO |
| InChI | InChI=1S/C6H14N4O2.C6H16N4O/c7-4(5(11)12)2-1-3-10-6(8)9;7-5(4-11)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);5,11H,1-4,7H2,(H4,8,9,10) |
| InChIKey | OLRJUSXVVFYSKZ-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 238.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|