C12H28N8O4Zn — CID 154941617
bis(2-amino-5-(diaminomethylideneamino)pentanoic acid);zinc (PubChem CID 154941617) has the molecular formula C12H28N8O4Zn and a molecular weight of 413.80 g/mol. Its IUPAC name is bis(2-amino-5-(diaminomethylideneamino)pentanoic acid);zinc.
| Compound Name | bis(2-amino-5-(diaminomethylideneamino)pentanoic acid);zinc |
|---|---|
| PubChem CID | 154941617 |
| Molecular Formula | C12H28N8O4Zn |
| Molecular Weight | 413.80 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | bis(2-amino-5-(diaminomethylideneamino)pentanoic acid);zinc |
| SMILES | NC(N)=NCCCC(N)C(=O)O.NC(N)=NCCCC(N)C(=O)O.[Zn] |
| InChI | InChI=1S/2C6H14N4O2.Zn/c2*7-4(5(11)12)2-1-3-10-6(8)9;/h2*4H,1-3,7H2,(H,11,12)(H4,8,9,10); |
| InChIKey | RLSBGGURBSZJLQ-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 255.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.80 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|