C7H18N4O2 — CID 146220305
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;methane (PubChem CID 146220305) has the molecular formula C7H18N4O2 and a molecular weight of 190.25 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;methane.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;methane |
|---|---|
| PubChem CID | 146220305 |
| Molecular Formula | C7H18N4O2 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;methane |
| SMILES | C.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.CH4/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H4/t4-;/m0./s1 |
| InChIKey | GJICHEAUDFHEIZ-WCCKRBBISA-N |
| XLogP | -0.91 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|