C10H20N4O8 — CID 162085050
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 162085050) has the molecular formula C10H20N4O8 and a molecular weight of 324.29 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 162085050 |
| Molecular Formula | C10H20N4O8 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C4H6O6/c7-4(5(11)12)2-1-3-10-6(8)9;5-1(3(7)8)2(6)4(9)10/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1-2,5-6H,(H,7,8)(H,9,10)/t4-;1-,2-/m01/s1 |
| InChIKey | ZCVVFWJFQMSYBO-PVVQJHSOSA-N |
| XLogP | -3.67 |
| TPSA | 242.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|