C7H17N5O3 — CID 174953444
2-amino-5-(diaminomethylideneamino)pentanoic acid;formamide (PubChem CID 174953444) has the molecular formula C7H17N5O3 and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;formamide.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;formamide |
|---|---|
| PubChem CID | 174953444 |
| Molecular Formula | C7H17N5O3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;formamide |
| SMILES | NC(N)=NCCCC(N)C(=O)O.NC=O |
| InChI | InChI=1S/C6H14N4O2.CH3NO/c7-4(5(11)12)2-1-3-10-6(8)9;2-1-3/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H,(H2,2,3) |
| InChIKey | CXPRAIXEOCVFRA-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 170.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|