C8H21ClN4O3 — CID 174671345
2-amino-5-(diaminomethylideneamino)pentanoic acid;ethanol;hydrochloride (PubChem CID 174671345) has the molecular formula C8H21ClN4O3 and a molecular weight of 256.73 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;ethanol;hydrochloride.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;ethanol;hydrochloride |
|---|---|
| PubChem CID | 174671345 |
| Molecular Formula | C8H21ClN4O3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;ethanol;hydrochloride |
| SMILES | CCO.Cl.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C2H6O.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;1-2-3;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,2H2,1H3;1H |
| InChIKey | QQGCIIGJZMDWNZ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|