C12H27N5O4 — CID 160879747
(2R)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-aminohexanoic acid (PubChem CID 160879747) has the molecular formula C12H27N5O4 and a molecular weight of 305.38 g/mol. Its IUPAC name is (2R)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-aminohexanoic acid.
| Compound Name | (2R)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-aminohexanoic acid |
|---|---|
| PubChem CID | 160879747 |
| Molecular Formula | C12H27N5O4 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (2R)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-aminohexanoic acid |
| SMILES | CCCC[C@@H](N)C(=O)O.NC(N)=NCCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C6H13NO2/c7-4(5(11)12)2-1-3-10-6(8)9;1-2-3-4-5(7)6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);5H,2-4,7H2,1H3,(H,8,9)/t4-;5-/m11/s1 |
| InChIKey | SMWMBVZZHPXBCV-JHRLVUGGSA-N |
| XLogP | -0.96 |
| TPSA | 191.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|