C10H25N7O2 — CID 87334568
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-propylguanidine (PubChem CID 87334568) has the molecular formula C10H25N7O2 and a molecular weight of 275.36 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-propylguanidine.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-propylguanidine |
|---|---|
| PubChem CID | 87334568 |
| Molecular Formula | C10H25N7O2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-propylguanidine |
| SMILES | CCCN=C(N)N.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C4H11N3/c7-4(5(11)12)2-1-3-10-6(8)9;1-2-3-7-4(5)6/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2-3H2,1H3,(H4,5,6,7)/t4-;/m0./s1 |
| InChIKey | XOIZKOGLKPDINC-WCCKRBBISA-N |
| XLogP | -1.88 |
| TPSA | 192.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|