C6H13BrN4O — CID 148549372
(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl bromide (PubChem CID 148549372) has the molecular formula C6H13BrN4O and a molecular weight of 237.10 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl bromide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl bromide |
|---|---|
| PubChem CID | 148549372 |
| Molecular Formula | C6H13BrN4O |
| Molecular Weight | 237.10 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoyl bromide |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)Br |
| InChI | InChI=1S/C6H13BrN4O/c7-5(12)4(8)2-1-3-11-6(9)10/h4H,1-3,8H2,(H4,9,10,11)/t4-/m0/s1 |
| InChIKey | RBZALASPACIGRE-BYPYZUCNSA-N |
| XLogP | -0.71 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.10 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|