C6H15N5O2 — CID 54278665
amino (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 54278665) has the molecular formula C6H15N5O2 and a molecular weight of 189.22 g/mol. Its IUPAC name is amino (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | amino (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 54278665 |
| Molecular Formula | C6H15N5O2 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | amino (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NOC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C6H15N5O2/c7-4(5(12)13-10)2-1-3-11-6(8)9/h4H,1-3,7,10H2,(H4,8,9,11)/t4-/m0/s1 |
| InChIKey | RPFOWJXHIVRTRS-BYPYZUCNSA-N |
| XLogP | -2.22 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|