C8H18N4O2 — CID 10130416
ethyl (2R)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 10130416) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is ethyl (2R)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | ethyl (2R)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 10130416 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | ethyl (2R)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | CCOC(=O)[C@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C8H18N4O2/c1-2-14-7(13)6(9)4-3-5-12-8(10)11/h6H,2-5,9H2,1H3,(H4,10,11,12)/t6-/m1/s1 |
| InChIKey | AKGWUHIOEVNNPC-ZCFIWIBFSA-N |
| XLogP | -1.07 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|