C10H24Cl2N4O2 — CID 66575041
tert-butyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride (PubChem CID 66575041) has the molecular formula C10H24Cl2N4O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride.
| Compound Name | tert-butyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
|---|---|
| PubChem CID | 66575041 |
| Molecular Formula | C10H24Cl2N4O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | tert-butyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)CCCN=C(N)N.Cl.Cl |
| InChI | InChI=1S/C10H22N4O2.2ClH/c1-10(2,3)16-8(15)7(11)5-4-6-14-9(12)13;;/h7H,4-6,11H2,1-3H3,(H4,12,13,14);2*1H/t7-;;/m0../s1 |
| InChIKey | QTFOKKSRMYGTQT-KLXURFKVSA-N |
| XLogP | 0.55 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|