C8H20Cl2N4O2 — CID 45073230
ethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride (PubChem CID 45073230) has the molecular formula C8H20Cl2N4O2 and a molecular weight of 275.18 g/mol. Its IUPAC name is ethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride.
| Compound Name | ethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
|---|---|
| PubChem CID | 45073230 |
| Molecular Formula | C8H20Cl2N4O2 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| SMILES | CCOC(=O)[C@@H](N)CCCN=C(N)N.Cl.Cl |
| InChI | InChI=1S/C8H18N4O2.2ClH/c1-2-14-7(13)6(9)4-3-5-12-8(10)11;;/h6H,2-5,9H2,1H3,(H4,10,11,12);2*1H/t6-;;/m0../s1 |
| InChIKey | RPFXMGGIQREZOH-ILKKLZGPSA-N |
| XLogP | -0.23 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|