C9H21ClN4O4 — CID 90331954
3,3-dihydroxypropyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;hydrochloride (PubChem CID 90331954) has the molecular formula C9H21ClN4O4 and a molecular weight of 284.74 g/mol. Its IUPAC name is 3,3-dihydroxypropyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;hydrochloride.
| Compound Name | 3,3-dihydroxypropyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;hydrochloride |
|---|---|
| PubChem CID | 90331954 |
| Molecular Formula | C9H21ClN4O4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3,3-dihydroxypropyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;hydrochloride |
| SMILES | Cl.NC(N)=NCCC[C@H](N)C(=O)OCCC(O)O |
| InChI | InChI=1S/C9H20N4O4.ClH/c10-6(2-1-4-13-9(11)12)8(16)17-5-3-7(14)15;/h6-7,14-15H,1-5,10H2,(H4,11,12,13);1H/t6-;/m0./s1 |
| InChIKey | LPZDTMJZFMLFHX-RGMNGODLSA-N |
| XLogP | -1.97 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|