C7H17N7O2 — CID 54219477
(diamino(114C)methylideneamino) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 54219477) has the molecular formula C7H17N7O2 and a molecular weight of 233.25 g/mol. Its IUPAC name is (diamino(114C)methylideneamino) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | (diamino(114C)methylideneamino) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 54219477 |
| Molecular Formula | C7H17N7O2 |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (diamino(114C)methylideneamino) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)ON=[14C](N)N |
| InChI | InChI=1S/C7H17N7O2/c8-4(2-1-3-13-6(9)10)5(15)16-14-7(11)12/h4H,1-3,8H2,(H4,9,10,13)(H4,11,12,14)/t4-/m0/s1/i7+2 |
| InChIKey | QBNXIPHAUQXGHS-UJYLGRPOSA-N |
| XLogP | -2.90 |
| TPSA | 181.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|