C9H20N4O4 — CID 175503093
acetic acid;methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 175503093) has the molecular formula C9H20N4O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is acetic acid;methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | acetic acid;methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 175503093 |
| Molecular Formula | C9H20N4O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | acetic acid;methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | CC(=O)O.COC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C7H16N4O2.C2H4O2/c1-13-6(12)5(8)3-2-4-11-7(9)10;1-2(3)4/h5H,2-4,8H2,1H3,(H4,9,10,11);1H3,(H,3,4)/t5-;/m0./s1 |
| InChIKey | MWQZMFVPFCLPPK-JEDNCBNOSA-N |
| XLogP | -1.37 |
| TPSA | 154.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|