C13H30Cl2N8O3 — CID 175713382
methyl (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoate;dihydrochloride (PubChem CID 175713382) has the molecular formula C13H30Cl2N8O3 and a molecular weight of 417.34 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoate;dihydrochloride.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
|---|---|
| PubChem CID | 175713382 |
| Molecular Formula | C13H30Cl2N8O3 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CCCN=C(N)N.Cl.Cl |
| InChI | InChI=1S/C13H28N8O3.2ClH/c1-24-11(23)9(5-3-7-20-13(17)18)21-10(22)8(14)4-2-6-19-12(15)16;;/h8-9H,2-7,14H2,1H3,(H,21,22)(H4,15,16,19)(H4,17,18,20);2*1H/t8-,9-;;/m0../s1 |
| InChIKey | WRKXMSKUXZXDBH-CDEWPDHBSA-N |
| XLogP | -2.08 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|