C11H23N5O4 — CID 126723432
methyl 2-[[(2S)-5-(diaminomethylideneamino)-2-(methylamino)pentanoyl]amino]-3-hydroxypropanoate (PubChem CID 126723432) has the molecular formula C11H23N5O4 and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl 2-[[(2S)-5-(diaminomethylideneamino)-2-(methylamino)pentanoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[(2S)-5-(diaminomethylideneamino)-2-(methylamino)pentanoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 126723432 |
| Molecular Formula | C11H23N5O4 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | methyl 2-[[(2S)-5-(diaminomethylideneamino)-2-(methylamino)pentanoyl]amino]-3-hydroxypropanoate |
| SMILES | CN[C@@H](CCCN=C(N)N)C(=O)NC(CO)C(=O)OC |
| InChI | InChI=1S/C11H23N5O4/c1-14-7(4-3-5-15-11(12)13)9(18)16-8(6-17)10(19)20-2/h7-8,14,17H,3-6H2,1-2H3,(H,16,18)(H4,12,13,15)/t7-,8?/m0/s1 |
| InChIKey | SSSWWSFUVJRCJW-JAMMHHFISA-N |
| XLogP | -2.72 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|