C13H28N6O2 — CID 174197575
(2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-(methylamino)pentanoyl]amino]-4-methylpentanamide (PubChem CID 174197575) has the molecular formula C13H28N6O2 and a molecular weight of 300.41 g/mol. Its IUPAC name is (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-(methylamino)pentanoyl]amino]-4-methylpentanamide.
| Compound Name | (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-(methylamino)pentanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 174197575 |
| Molecular Formula | C13H28N6O2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-(methylamino)pentanoyl]amino]-4-methylpentanamide |
| SMILES | CN[C@H](CCCN=C(N)N)C(=O)N[C@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C13H28N6O2/c1-8(2)7-10(11(14)20)19-12(21)9(17-3)5-4-6-18-13(15)16/h8-10,17H,4-7H2,1-3H3,(H2,14,20)(H,19,21)(H4,15,16,18)/t9-,10-/m1/s1 |
| InChIKey | XJJGLGNMSKDXOT-NXEZZACHSA-N |
| XLogP | -1.36 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|