C12H30N4O — CID 145328889
ethane;2-[4-(methylamino)-5-oxohexyl]guanidine (PubChem CID 145328889) has the molecular formula C12H30N4O and a molecular weight of 246.40 g/mol. Its IUPAC name is ethane;2-[4-(methylamino)-5-oxohexyl]guanidine.
| Compound Name | ethane;2-[4-(methylamino)-5-oxohexyl]guanidine |
|---|---|
| PubChem CID | 145328889 |
| Molecular Formula | C12H30N4O |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.24 |
| IUPAC Name | ethane;2-[4-(methylamino)-5-oxohexyl]guanidine |
| SMILES | CC.CC.CNC(CCCN=C(N)N)C(C)=O |
| InChI | InChI=1S/C8H18N4O.2C2H6/c1-6(13)7(11-2)4-3-5-12-8(9)10;2*1-2/h7,11H,3-5H2,1-2H3,(H4,9,10,12);2*1-2H3 |
| InChIKey | OIIHWWJBDXKGBS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|