C7H18N4 — CID 59032682
2-[(4R)-4-(methylamino)pentyl]guanidine (PubChem CID 59032682) has the molecular formula C7H18N4 and a molecular weight of 158.25 g/mol. Its IUPAC name is 2-[(4R)-4-(methylamino)pentyl]guanidine.
| Compound Name | 2-[(4R)-4-(methylamino)pentyl]guanidine |
|---|---|
| PubChem CID | 59032682 |
| Molecular Formula | C7H18N4 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | 2-[(4R)-4-(methylamino)pentyl]guanidine |
| SMILES | CN[C@H](C)CCCN=C(N)N |
| InChI | InChI=1S/C7H18N4/c1-6(10-2)4-3-5-11-7(8)9/h6,10H,3-5H2,1-2H3,(H4,8,9,11)/t6-/m1/s1 |
| InChIKey | QBOPQOHAJYGNKC-ZCFIWIBFSA-N |
| XLogP | -0.35 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|