C18H39N7O2S — CID 165092390
(2S)-6-(diaminomethylideneamino)-N-[(5R)-5-(methylamino)hexyl]-2-[[(2R)-2-(methylamino)-3-sulfanylpropanoyl]amino]hexanamide (PubChem CID 165092390) has the molecular formula C18H39N7O2S and a molecular weight of 417.62 g/mol. Its IUPAC name is (2S)-6-(diaminomethylideneamino)-N-[(5R)-5-(methylamino)hexyl]-2-[[(2R)-2-(methylamino)-3-sulfanylpropanoyl]amino]hexanamide.
| Compound Name | (2S)-6-(diaminomethylideneamino)-N-[(5R)-5-(methylamino)hexyl]-2-[[(2R)-2-(methylamino)-3-sulfanylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 165092390 |
| Molecular Formula | C18H39N7O2S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (2S)-6-(diaminomethylideneamino)-N-[(5R)-5-(methylamino)hexyl]-2-[[(2R)-2-(methylamino)-3-sulfanylpropanoyl]amino]hexanamide |
| SMILES | CN[C@H](C)CCCCNC(=O)[C@H](CCCCN=C(N)N)NC(=O)[C@H](CS)NC |
| InChI | InChI=1S/C18H39N7O2S/c1-13(21-2)8-4-6-10-23-16(26)14(9-5-7-11-24-18(19)20)25-17(27)15(12-28)22-3/h13-15,21-22,28H,4-12H2,1-3H3,(H,23,26)(H,25,27)(H4,19,20,24)/t13-,14+,15+/m1/s1 |
| InChIKey | WXYGMUBMOLCJJQ-ILXRZTDVSA-N |
| XLogP | -0.67 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|