C20H42N8O3 — CID 53329971
(2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-[5-(diaminomethylideneamino)pentylamino]-1-oxohexan-2-yl]hexanamide (PubChem CID 53329971) has the molecular formula C20H42N8O3 and a molecular weight of 442.61 g/mol. Its IUPAC name is (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-[5-(diaminomethylideneamino)pentylamino]-1-oxohexan-2-yl]hexanamide.
| Compound Name | (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-[5-(diaminomethylideneamino)pentylamino]-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 53329971 |
| Molecular Formula | C20H42N8O3 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-[5-(diaminomethylideneamino)pentylamino]-1-oxohexan-2-yl]hexanamide |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)NCCCCCN=C(N)N |
| InChI | InChI=1S/C20H42N8O3/c1-15(29)27-17(10-4-6-12-22)19(31)28-16(9-3-5-11-21)18(30)25-13-7-2-8-14-26-20(23)24/h16-17H,2-14,21-22H2,1H3,(H,25,30)(H,27,29)(H,28,31)(H4,23,24,26)/t16-,17-/m0/s1 |
| InChIKey | BBYQUMLDPPIIOP-IRXDYDNUSA-N |
| XLogP | -1.21 |
| TPSA | 203.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|