C23H44N8O5 — CID 10217937
(2S)-6-acetamido-2-[[(2S)-2-acetamidopentanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-(ethylamino)-1-oxopentan-2-yl]hexanamide (PubChem CID 10217937) has the molecular formula C23H44N8O5 and a molecular weight of 512.66 g/mol. Its IUPAC name is (2S)-6-acetamido-2-[[(2S)-2-acetamidopentanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-(ethylamino)-1-oxopentan-2-yl]hexanamide.
| Compound Name | (2S)-6-acetamido-2-[[(2S)-2-acetamidopentanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-(ethylamino)-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 10217937 |
| Molecular Formula | C23H44N8O5 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | (2S)-6-acetamido-2-[[(2S)-2-acetamidopentanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-(ethylamino)-1-oxopentan-2-yl]hexanamide |
| SMILES | CCC[C@H](NC(C)=O)C(=O)N[C@@H](CCCCNC(C)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC |
| InChI | InChI=1S/C23H44N8O5/c1-5-10-17(29-16(4)33)21(35)31-19(11-7-8-13-27-15(3)32)22(36)30-18(20(34)26-6-2)12-9-14-28-23(24)25/h17-19H,5-14H2,1-4H3,(H,26,34)(H,27,32)(H,29,33)(H,30,36)(H,31,35)(H4,24,25,28)/t17-,18-,19-/m0/s1 |
| InChIKey | KIXCYAQPOJOPKZ-FHWLQOOXSA-N |
| XLogP | -1.24 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|