C19H31BN6O5 — CID 70701974
[4-[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-3-(ethylamino)-3-oxopropyl]phenyl]boronic acid (PubChem CID 70701974) has the molecular formula C19H31BN6O5 and a molecular weight of 434.31 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-3-(ethylamino)-3-oxopropyl]phenyl]boronic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-3-(ethylamino)-3-oxopropyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 70701974 |
| Molecular Formula | C19H31BN6O5 |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-3-(ethylamino)-3-oxopropyl]phenyl]boronic acid |
| SMILES | CCNC(=O)[C@H](Cc1ccc(B(O)O)cc1)NC(=O)[C@H](CCCN=C(N)N)NC(C)=O |
| InChI | InChI=1S/C19H31BN6O5/c1-3-23-17(28)16(11-13-6-8-14(9-7-13)20(30)31)26-18(29)15(25-12(2)27)5-4-10-24-19(21)22/h6-9,15-16,30-31H,3-5,10-11H2,1-2H3,(H,23,28)(H,25,27)(H,26,29)(H4,21,22,24)/t15-,16-/m0/s1 |
| InChIKey | KSIKUMFPKDKTJF-HOTGVXAUSA-N |
| XLogP | -2.91 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|