C21H34N8O5 — CID 129232247
2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)-N-[2-[[1-(ethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]pentanamide (PubChem CID 129232247) has the molecular formula C21H34N8O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)-N-[2-[[1-(ethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]pentanamide.
| Compound Name | 2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)-N-[2-[[1-(ethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 129232247 |
| Molecular Formula | C21H34N8O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)-N-[2-[[1-(ethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]pentanamide |
| SMILES | CCNC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)C(CCCN=C(N)N)NC(=O)CN |
| InChI | InChI=1S/C21H34N8O5/c1-2-25-20(34)16(10-13-5-7-14(30)8-6-13)29-18(32)12-27-19(33)15(28-17(31)11-22)4-3-9-26-21(23)24/h5-8,15-16,30H,2-4,9-12,22H2,1H3,(H,25,34)(H,27,33)(H,28,31)(H,29,32)(H4,23,24,26) |
| InChIKey | GYPAOSFSMYAPJM-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 227.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|