C11H23N5O2 — CID 170521872
(2S)-5-(diaminomethylideneamino)-N-ethyl-2-(propanoylamino)pentanamide (PubChem CID 170521872) has the molecular formula C11H23N5O2 and a molecular weight of 257.34 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-N-ethyl-2-(propanoylamino)pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-N-ethyl-2-(propanoylamino)pentanamide |
|---|---|
| PubChem CID | 170521872 |
| Molecular Formula | C11H23N5O2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-N-ethyl-2-(propanoylamino)pentanamide |
| SMILES | CCNC(=O)[C@H](CCCN=C(N)N)NC(=O)CC |
| InChI | InChI=1S/C11H23N5O2/c1-3-9(17)16-8(10(18)14-4-2)6-5-7-15-11(12)13/h8H,3-7H2,1-2H3,(H,14,18)(H,16,17)(H4,12,13,15)/t8-/m0/s1 |
| InChIKey | OFOSLYRRHRXJIL-QMMMGPOBSA-N |
| XLogP | -0.93 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|