C14H24N6O7 — CID 90824975
2-[[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]butanedioic acid (PubChem CID 90824975) has the molecular formula C14H24N6O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-[[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 90824975 |
| Molecular Formula | C14H24N6O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]butanedioic acid |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H24N6O7/c1-7(21)19-8(3-2-4-17-14(15)16)12(25)18-6-10(22)20-9(13(26)27)5-11(23)24/h8-9H,2-6H2,1H3,(H,18,25)(H,19,21)(H,20,22)(H,23,24)(H,26,27)(H4,15,16,17) |
| InChIKey | CZQRMCSKNKGDCP-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 226.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|