C18H30N8O7 — CID 102211811
(3S)-4-amino-3-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]pentanoyl]amino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 102211811) has the molecular formula C18H30N8O7 and a molecular weight of 470.49 g/mol. Its IUPAC name is (3S)-4-amino-3-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]pentanoyl]amino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-amino-3-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]pentanoyl]amino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 102211811 |
| Molecular Formula | C18H30N8O7 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | (3S)-4-amino-3-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]pentanoyl]amino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | C=C(C)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(N)=O |
| InChI | InChI=1S/C18H30N8O7/c1-9(2)16(32)23-7-12(27)25-10(4-3-5-22-18(20)21)17(33)24-8-13(28)26-11(15(19)31)6-14(29)30/h10-11H,1,3-8H2,2H3,(H2,19,31)(H,23,32)(H,24,33)(H,25,27)(H,26,28)(H,29,30)(H4,20,21,22)/t10-,11-/m0/s1 |
| InChIKey | CLBLPAMULHXQJN-QWRGUYRKSA-N |
| XLogP | -4.22 |
| TPSA | 261.19 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|