C16H32N6O4 — CID 178159201
3-[[2-[[3-amino-6-(diaminomethylideneamino)hex-1-en-2-yl]amino]acetyl]amino]-4-oxopentanoic acid;ethane (PubChem CID 178159201) has the molecular formula C16H32N6O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-[[2-[[3-amino-6-(diaminomethylideneamino)hex-1-en-2-yl]amino]acetyl]amino]-4-oxopentanoic acid;ethane.
| Compound Name | 3-[[2-[[3-amino-6-(diaminomethylideneamino)hex-1-en-2-yl]amino]acetyl]amino]-4-oxopentanoic acid;ethane |
|---|---|
| PubChem CID | 178159201 |
| Molecular Formula | C16H32N6O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 3-[[2-[[3-amino-6-(diaminomethylideneamino)hex-1-en-2-yl]amino]acetyl]amino]-4-oxopentanoic acid;ethane |
| SMILES | C=C(NCC(=O)NC(CC(=O)O)C(C)=O)C(N)CCCN=C(N)N.CC |
| InChI | InChI=1S/C14H26N6O4.C2H6/c1-8(10(15)4-3-5-18-14(16)17)19-7-12(22)20-11(9(2)21)6-13(23)24;1-2/h10-11,19H,1,3-7,15H2,2H3,(H,20,22)(H,23,24)(H4,16,17,18);1-2H3 |
| InChIKey | RIDOXOFUPLZECD-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|