C13H24N6O6 — CID 163422398
2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 163422398) has the molecular formula C13H24N6O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163422398 |
| Molecular Formula | C13H24N6O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)CC(NC(=O)CNC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C13H24N6O6/c1-25-10(21)5-8(12(23)24)19-9(20)6-18-11(22)7(14)3-2-4-17-13(15)16/h7-8H,2-6,14H2,1H3,(H,18,22)(H,19,20)(H,23,24)(H4,15,16,17) |
| InChIKey | AJNSQYVAGNMIRO-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 212.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|