C12H22N6O6 — CID 18219496
2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18219496) has the molecular formula C12H22N6O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18219496 |
| Molecular Formula | C12H22N6O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)CNC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H22N6O6/c13-6(4-9(20)21)10(22)17-5-8(19)18-7(11(23)24)2-1-3-16-12(14)15/h6-7H,1-5,13H2,(H,17,22)(H,18,19)(H,20,21)(H,23,24)(H4,14,15,16) |
| InChIKey | YNCHFVRXEQFPBY-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|