C12H23N7O6 — CID 102422579
(3S)-3-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-aminooxy-4-oxobutanoic acid (PubChem CID 102422579) has the molecular formula C12H23N7O6 and a molecular weight of 361.36 g/mol. Its IUPAC name is (3S)-3-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-aminooxy-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-aminooxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 102422579 |
| Molecular Formula | C12H23N7O6 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (3S)-3-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-aminooxy-4-oxobutanoic acid |
| SMILES | NOC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C12H23N7O6/c13-6(2-1-3-17-12(14)15)10(23)18-5-8(20)19-7(4-9(21)22)11(24)25-16/h6-7H,1-5,13,16H2,(H,18,23)(H,19,20)(H,21,22)(H4,14,15,17)/t6-,7-/m0/s1 |
| InChIKey | FMLHFGRUPBXWOF-BQBZGAKWSA-N |
| XLogP | -4.14 |
| TPSA | 238.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|